|
| | 7-Aminodesacetoxycephalosporanic acid Basic information |
| Product Name: | 7-Aminodesacetoxycephalosporanic acid | | Synonyms: | 7-Amino-3-methyl-3-cephem-4-carboxylic acid(7-ADCA);( 7-AMINO DESACETOXY CEPALOSPHORANIC ACID;7-AMINODESACETOXYCEPHALOSPORANIC ACID, 98;7-Phenglacetamido-3-chloromethyl-3-cephem-4-carboxylic acid p-methoxybenzyl ester;7-ADCA 98.5+%;7-ADCA;7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;7-Aminodesacetoxycephalosporanic acid | | CAS: | 26395-99-3 | | MF: | C8H10N2O3S | | MW: | 214.24 | | EINECS: | 247-654-5 | | Product Categories: | pharmacetical | | Mol File: | 26395-99-3.mol |  |
| | 7-Aminodesacetoxycephalosporanic acid Chemical Properties |
| Melting point | >185°C (dec._) | | Boiling point | 517.6±50.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly), DMSO (Very Slightly, Heated) | | form | Solid | | pka | 3.04±0.50(Predicted) | | color | White to Pale Beige | | InChI | InChI=1S/C8H10N2O3S/c1-3-2-14-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13) | | InChIKey | NVIAYEIXYQCDAN-UHFFFAOYSA-N | | SMILES | N12C(C(N)C1=O)SCC(C)=C2C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 42/43 | | Safety Statements | 36 |
| | 7-Aminodesacetoxycephalosporanic acid Usage And Synthesis |
| Uses | 7-Aminodesacetoxycephalosporanic Acid (Cefadroxil EP Impurity B) is a metabolite of Cephalexin (C256800). |
| | 7-Aminodesacetoxycephalosporanic acid Preparation Products And Raw materials |
|
