|
| | 2,4-Dichloro-6-phenyl-1,3,5-triazine Basic information |
| Product Name: | 2,4-Dichloro-6-phenyl-1,3,5-triazine | | Synonyms: | 2,4-Dichloro-6-phenyl-1,3,5-triazine 98%;4,6-DICHLORO-2-PHENYL TRIAZINE;1,3,5-TRIAZINE-2,4-DICHLORO, 6-PHENYL-;2,4-DICHLORO-6-PHENYL-1,3,5-TRIAZINE;2-[(4-AMINO-3-CHLORO)BENZOYL]BENZOIC ACID;2,4-Dichloro-Phenyl-1,3,5-Triazine;2-Phenyl-4,6-dichlorotriazine;4,6-Dichloro-2-phenyl-1,3,5-triazine | | CAS: | 1700-02-3 | | MF: | C9H5Cl2N3 | | MW: | 226.06 | | EINECS: | 216-928-6 | | Product Categories: | OLED;1,3,5-triazine | | Mol File: | 1700-02-3.mol |  |
| | 2,4-Dichloro-6-phenyl-1,3,5-triazine Chemical Properties |
| Melting point | gt. 119.0 to 123.0 °C | | Boiling point | 136°C/1mmHg(lit.) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -1.67±0.10(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C9H5Cl2N3/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6/h1-5H | | InChIKey | AMEVJOWOWQPPJQ-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=CC=C2)N=C(Cl)N=C1Cl | | CAS DataBase Reference | 1700-02-3(CAS DataBase Reference) |
| | 2,4-Dichloro-6-phenyl-1,3,5-triazine Usage And Synthesis |
| Description | 2,4-Dichloro-6-phenyl-1,3,5-triazine is a heterocyclic derivative and can be used as intermediate of synthetic materials. | | Chemical Properties | White to Orange to Green powder to crystal. | | Uses | 2,4-Dichloro-6-phenyl-1,3,5-triazine, is a building block as an OLED intermediate for the synthesis of bipolar host materials such as 2,4,6-tris(4-(N,N-diphenylamino)phenyl)-1,3,5-triazine (TDPA–TRZ) for phosphorescent organic light-emitting diodes (PhOLED). | | Synthesis | 2,4-Dichloro-6-phenyl-1,3,5-triazine was prepared by reaction of 36.2 g (0.21 mol) of 2,4-dihydroxy-6-phenyl-1 ,3,5-triazine with 180 g (1.51 mol) of thionyl chloride and 17.3 g of N,N-dimethylformamide (DMF) at 60°C for 3 h. The excess thionyl chloride was distilled,and the residue was poured into water to give a product.The white product was filtered off, dried, and recrys-tallized from benzene to give a yield of 22.0 g (47.4%).
 |
| | 2,4-Dichloro-6-phenyl-1,3,5-triazine Preparation Products And Raw materials |
|