|
| | N-Carbobenzyloxy-L-valine Basic information |
| | N-Carbobenzyloxy-L-valine Chemical Properties |
| Melting point | 62-64 °C(lit.) | | alpha | -4 º (c=2,acetic acid) | | Boiling point | 394.43°C (rough estimate) | | density | 0,926g/cm | | refractive index | -4.3 ° (C=2, AcOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Acetic Acid, DMSO (Slightly), Ethanol (Slightly) | | pka | 4.00±0.10(Predicted) | | form | Crystalline Powder | | color | White to off-white | | optical activity | [α]20/D 4.2±0.5°, c = 2 in chloroform | | BRN | 2056617 | | InChI | InChI=1S/C13H17NO4/c1-9(2)11(12(15)16)14-13(17)18-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,14,17)(H,15,16)/t11-/m0/s1 | | InChIKey | CANZBRDGRHNSGZ-NSHDSACASA-N | | SMILES | C(O)(=O)[C@H](C(C)C)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 1149-26-4(CAS DataBase Reference) |
| | N-Carbobenzyloxy-L-valine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Imatinib intermediate | | Uses | Valaciclovir intermediate | | Uses | N-Cbz-L-valine is an N-Cbz-protected form of L-Valine (V094205). L-Valine is an essential amino acid that is used as an ingredient in cosmetic formulations, pharmaceuticals, and animal feed products. L-valine is also important for growth and ammonia detoxification in humans. | | Synthesis Reference(s) | Synthesis, p. 738, 1985 DOI: 10.1055/s-1985-31329 |
| | N-Carbobenzyloxy-L-valine Preparation Products And Raw materials |
|