|
| | AMinopentaMide Sulfate Basic information |
| | AMinopentaMide Sulfate Chemical Properties |
| solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C19H24N2O.H2O4S/c1-15(21(2)3)14-19(18(20)22,16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-5(2,3)4/h4-13,15H,14H2,1-3H3,(H2,20,22);(H2,1,2,3,4) | | InChIKey | GEKOQGPXZRQQHJ-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)(C(=O)N)CC(C)N(C)C.S(O)(O)(=O)=O |
| | AMinopentaMide Sulfate Usage And Synthesis |
| Uses | Aminopentamide Sulfate affects gastric function and gastroduodenal ulcus. Used in the treatment of vomiting, diarrhea and other side effects in dogs/cats. |
| | AMinopentaMide Sulfate Preparation Products And Raw materials |
|
