|
| | 1-(3-Methoxypropyl)-4-piperidinamine Basic information |
| Product Name: | 1-(3-Methoxypropyl)-4-piperidinamine | | Synonyms: | 1-(3-Methoxypropyl)-4-piperidinamine;4-AMino-1-(3-Methoxypropyl)piperidine;4-AMino-1-(3-Methoxypropy...;4-PiperidinaMine, 1-(3-Methoxypropyl)-;1-(3-Methoxypropyl)piperidin-4-aMine;Prucalopride Succinate interMediate B;Prucalopride intermediateB;1-(3-Methoxypropyl)-4-piperidimine | | CAS: | 179474-79-4 | | MF: | C9H20N2O | | MW: | 172.27 | | EINECS: | 431-950-8 | | Product Categories: | | | Mol File: | 179474-79-4.mol |  |
| | 1-(3-Methoxypropyl)-4-piperidinamine Chemical Properties |
| Boiling point | 249℃ | | density | 0.946 | | Fp | 105℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.49±0.20(Predicted) | | form | Oil | | color | Colourless to Pale Yellow | | InChI | InChI=1S/C9H20N2O/c1-12-8-2-5-11-6-3-9(10)4-7-11/h9H,2-8,10H2,1H3 | | InChIKey | HIXAJGFVNMKLML-UHFFFAOYSA-N | | SMILES | N1(CCCOC)CCC(N)CC1 |
| | 1-(3-Methoxypropyl)-4-piperidinamine Usage And Synthesis |
| Uses | 1-(3-Methoxypropyl)-4-piperidinamine is a useful synthetic intermediate in the synthesis of Prucalopride Succinate (P838950); a selective 5-HT4 receptor agonist used effective for chronic constipation, but is not currently approved in the U.S. Prucalopride is approved for the treatment of chronic constipation in Europe. | | Synthesis | N-(1-(3-methoxypropyl)piperidin-4-yl)acetamide (10.72g, 0.05mol) was added to HCl-methanol solution (0.5M, 180ml), and the temperature was controlled at 2025°C After the reaction was detected, it was filtered, and the filter cake was washed with dichloromethane and dried to obtain 1-(3-Methoxypropyl)-4-piperidinamine with a yield of 96.4% and a purity of 99.7%. |
| | 1-(3-Methoxypropyl)-4-piperidinamine Preparation Products And Raw materials |
|
