|
| | trans-1,4-Cyclohexanedicarboxybic acid Basic information |
| | trans-1,4-Cyclohexanedicarboxybic acid Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 262.49°C (rough estimate) | | density | 1.2104 (rough estimate) | | refractive index | 1.4795 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pK1:4.18 ;pK2:5.42 (16°C) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Soluble in hot methanol (almost transparency), ethanol, acetone. Slightly soluble in ether and water | | InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6- | | InChIKey | PXGZQGDTEZPERC-IZLXSQMJSA-N | | SMILES | [C@@H]1(C(O)=O)CC[C@@H](C(O)=O)CC1 | | CAS DataBase Reference | 619-82-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Cyclohexanedicarboxylic acid, trans-(619-82-9) |
| | trans-1,4-Cyclohexanedicarboxybic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | It is a pharmaceutical intermediate. | | Definition | ChEBI: 1,4-cyclohexanedicarboxylic acid is a dicarboxylic acid that is cyclohexane substituted by carboxy groups at positions 1 and 4. |
| | trans-1,4-Cyclohexanedicarboxybic acid Preparation Products And Raw materials |
|
