|
| | 3-[N,N-Bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonic acid Basic information |
| | 3-[N,N-Bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonic acid Chemical Properties |
| Melting point | 189-192 °C(lit.) | | density | 1.494±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | H2O: 0.1 M at 20 °C, clear, colorless | | form | powder to crystal | | color | White to Almost white | | PH | 4.0-5.5 (20℃, 0.1M in H2O) | | PH Range | 7.0 - 8.2 | | pka | 7.6(at 25℃) | | Water Solubility | almost transparency | | BRN | 2105454 | | InChI | InChI=1S/C7H17NO6S/c9-3-1-8(2-4-10)5-7(11)6-15(12,13)14/h7,9-11H,1-6H2,(H,12,13,14) | | InChIKey | XCBLFURAFHFFJF-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)C(O)CN(CCO)CCO | | CAS DataBase Reference | 68399-80-4(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanesulfonic acid, 3-[bis(2-hydroxyethyl)amino]-2-hydroxy- (68399-80-4) |
| | 3-[N,N-Bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonic acid Usage And Synthesis |
| Chemical Properties | white powder |
| | 3-[N,N-Bis(2-hydroxyethyl)amino]-2-hydroxy-1-propanesulfonic acid Preparation Products And Raw materials |
|