|
| | Valiolamine Basic information |
| Product Name: | Valiolamine | | Synonyms: | VALIOLAMINE;4-amino-3,4-dideoxy-2-c-(hydroxymethyl)-d-epi-inositohydrate;4-amino-3,4-dideoxy-2-c-(hydroxymethyl)-d-epi-inositolhydrate;VALIOLAMINE (4-AMINO-3,4-DIDEOXY-2-C-(HYDROXYMETHYL)-D-EPI-INOSITO);(1S,2S,3R,4S,5S)-5-Amino-1-hydroxymethylcyclohexane-1,2,3,4-tetranol;(1S)-1,2β,3α,4β-Tetrahydroxy-5β-aminocyclohexane-1α-methanol;D-epi-Inositol, 4-amino-3,4-dideoxy-2-C-(hydroxymethyl)-(Valiolamine);(1S,2S,3R,4S,5S)-5-Amino-1-(hydroxymethyl)-1,2,3,4-cyclohexanetetrol | | CAS: | 83465-22-9 | | MF: | C7H15NO5 | | MW: | 193.2 | | EINECS: | | | Product Categories: | Miscellaneous Biochemicals;VOGLIBOSE | | Mol File: | 83465-22-9.mol |  |
| | Valiolamine Chemical Properties |
| Melting point | 146-148°C | | Boiling point | 368.6±42.0 °C(Predicted) | | density | 1.623±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated), Water (Sparingly) | | form | Solid | | pka | 13.27±0.70(Predicted) | | color | Off-White | | InChI | InChI=1S/C7H15NO5/c8-3-1-7(13,2-9)6(12)5(11)4(3)10/h3-6,9-13H,1-2,8H2/t3-,4-,5+,6-,7-/m1/s1 | | InChIKey | VDLOJRUTNRJDJO-XUUWZHRGSA-N | | SMILES | O[C@@H]1[C@@H](O)[C@H](O)[C@H](N)C[C@]1(CO)O | | CAS DataBase Reference | 83465-22-9(CAS DataBase Reference) |
| | Valiolamine Usage And Synthesis |
| Uses | Valiolamine is a aminocyclitol that exhibits potent alpha-D-glucosidase inhibitory activity against porcine intestinal sucrase, maltase and isomaltase. |
| | Valiolamine Preparation Products And Raw materials |
|
