| 
 |  | Allyl (3-methylbutoxy)acetate Basic information |  
  
 |  | Allyl (3-methylbutoxy)acetate Chemical Properties |  
 | Boiling point  | 206-226 °C(lit.) |  | density  | 0.937 g/mL at 25 °C(lit.) |  | vapor pressure  | 19.7Pa at 25℃ |  | refractive index  | n20/D 1.4317(lit.) |  | Fp  | 205 °F |  | form  | clear liquid |  | color  | Colorless to Very pale yellow |  | Odor | at 10.00 % in dipropylene glycol. fruity green galbanum pineapple fusel |  | Odor Type | fruity |  | Water Solubility  | 1μg/L at 20℃ |  | InChI | InChI=1S/C10H18O3/c1-4-6-13-10(11)8-12-7-5-9(2)3/h4,9H,1,5-8H2,2-3H3 |  | InChIKey | XCWPXUNHSPOFGV-UHFFFAOYSA-N |  | SMILES | C(OCC=C)(=O)COCCC(C)C |  | LogP | 1.96 at 25℃ |  | CAS DataBase Reference | 67634-00-8(CAS DataBase Reference) |  | EPA Substance Registry System | Acetic acid, 2-(3-methylbutoxy)-, 2-propen-1-yl ester (67634-00-8) |  
  
| Hazard Codes  | Xi |  | Risk Statements  | 36/37/38 |  | Safety Statements  | 26-36 |  | WGK Germany  | 2 |  | RTECS  | AI8988000 |  | HS Code  | 2916.19.3000 |  
  
 |  | Allyl (3-methylbutoxy)acetate Usage And Synthesis |  
 | Chemical Properties | Allyl (3-Methylbutoxy)acetate is a colorless liquid of
strong, fruity galbanum odor with pineapple modification. It can be prepared
by reaction of chloroacetic acid with isoamyl alcohol in the presence of sodium
hydroxide and a phase-transfer catalyst, then treating the resulting sodium
amylglycolate with allyl alcohol. Allyl amylglycolate is used in fragrance
compositions, for example, for detergents. |  | General Description | Clear colorless liquid. |  | Air & Water Reactions | Insoluble in water. |  | Reactivity Profile | Allyl (3-methylbutoxy)acetate may react with strong oxidizing acids sufficiently exothermically to ignite the reaction products. Also generates heat with caustic solutions. May generate flammable hydrogen with alkali metals, hydrides, and other reducing agents. |  | Fire Hazard | Allyl (3-methylbutoxy)acetate is combustible. |  | Flammability and Explosibility | Notclassified |  
  
 |  | Allyl (3-methylbutoxy)acetate Preparation Products And Raw materials |  
  
 
 |