|
| | Squalene Basic information |
| Product Name: | Squalene | | Synonyms: | 2,6,10,14,18,22-Tetracosahexaene, 2,6,10,15,19,23-hexamethyl-;Skvalen;Sqalene;SQUALENE OIL;SQUALENE;SPINACENE;2,6,10,15,19,23-HEXAMETHYL-2,6,10,14,18,22-TETRACOSAHEXAENE;2,6,10,15,19,23-HEXAMETHYL-2, 6, 10, 14, 18, 22-TETRACOSAHEXENE | | CAS: | 7683-64-9 | | MF: | C30H50 | | MW: | 410.72 | | EINECS: | 203-826-1 | | Product Categories: | | | Mol File: | 7683-64-9.mol |  |
| | Squalene Chemical Properties |
| Melting point | −75 °C(lit.) | | Boiling point | 285 °C25 mm Hg(lit.) | | density | 0.858 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.494(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | liquid | | color | light yellow | | InChI | InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3 | | InChIKey | YYGNTYWPHWGJRM-UHFFFAOYSA-N | | SMILES | C/C(/C)=C\CCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC/C=C(/C)\C | | LogP | 12.188 (est) | | NIST Chemistry Reference | Squalene(7683-64-9) | | EPA Substance Registry System | Spinacene (7683-64-9) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | RTECS | XB6010000 | | F | 8-10-23 |
| | Squalene Usage And Synthesis |
| Uses | squalene is like squalane, squalene replenishes skin lipids while softening and smoothing. It helps maintain the skin in good condition. When used in hair care products, it serves as a hairconditioning and anti-static agent. | | Uses | Spinacene can be used for its antioxidant properties using its essential oils derived from its leaves and stem, including, effective larvacides | | Definition | squalene: An intermediate compoundformed in the synthesis ofcholesterol; it is a hydrocarbon containing30 carbon atoms. The immediateoxidation of squalene tosqualene 2,3-epoxide is the last commonstep in the synthesis of sterolsin animals, plants, and fungi. |
| | Squalene Preparation Products And Raw materials |
|
