|
| | Oxamic acid sodium salt Basic information |
| Product Name: | Oxamic acid sodium salt | | Synonyms: | aminooxo-aceticacimonosodiumsalt;AMINOOXOACETIC ACID SODIUM SALT;OXALIC ACID MONOAMIDE SODIUM SALT;OXAMIC ACID SODIUM SALT;oxamic acid sodium;OxamicacidsodiumsaltOxamicacidsodiumsalt;Aminooxoacetic acid sodium salt, Oxalic acid monoamide sodium salt, Oxamic acid sodium salt;2-Amino-2-oxoacetic acid sodium salt | | CAS: | 565-73-1 | | MF: | C2H2NNaO3 | | MW: | 111.03 | | EINECS: | 209-290-5 | | Product Categories: | | | Mol File: | 565-73-1.mol |  |
| | Oxamic acid sodium salt Chemical Properties |
| Melting point | 300 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | PBS (pH 7.2): 10 mg/ml | | form | solid | | Water Solubility | Soluble in water (10 mg/ml). | | BRN | 6538153 | | InChI | InChI=1S/C2H3NO3.Na/c3-1(4)2(5)6;/h(H2,3,4)(H,5,6);/q;+1/p-1 | | InChIKey | RQVZIJIQDCGIKI-UHFFFAOYSA-M | | SMILES | C(=O)(N)C([O-])=O.[Na+] | | CAS DataBase Reference | 565-73-1(CAS DataBase Reference) | | EPA Substance Registry System | Sodium oxamate (565-73-1) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | TSCA | Yes | | HS Code | 29241990 |
| | Oxamic acid sodium salt Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Oxamic acid sodium salt is a lactate dehydrogenase (LDH) inhibitor. It is a suitable compound to investigate cancer cells that utilize the glycolytic pathway.This compound is suitable for lactate dehydrogenase (LDH) related research. It can be used as an inhibitor of gluconeogenesis useful for anticancer research. | | Application | Sodium oxamate, an inhibitor of LDH-C4, prevented the AR induced by lysophosphatidylcholine (LPC) or NADH. Oxamic acid sodium salt is an lactic acid dehydrogenase. Sperm suspension and cytosol fraction activities were inhibited by sodium oxamate. As cancer cells are often dependent on glycolysis for ATP production, sodium oxamate has implications as an anticancer compound. | | Biochem/physiol Actions | Sodium oxamate influences the fatty acid metabolism. It might be useful for the treatment of diabetes. |
| | Oxamic acid sodium salt Preparation Products And Raw materials |
|