|
| | trans-Methyl 3-hydroxycyclobutanecarboxylate Basic information | | Appearance |
| Product Name: | trans-Methyl 3-hydroxycyclobutanecarboxylate | | Synonyms: | Methyl trans-3-hydroxycyc...;Methyl trans-3-hydroxycyclobutanecarboxylate;Cyclobutanecarboxylic acid, 3-hydroxy-, Methyl ester, trans-;3r)-Methyl 3-hydroxycyclobutanecarboxylate;trans-Methyl 3-hydroxycyclobutanecarboxylate;trans-3-Hydroxy-cyclobutane-carboxylic acid methyl ester;methyl(1r,3r)-3-hydroxycyclobutane-1-carboxylate;(1s,3s)-3-hydroxycyclobutane-1-carboxylic acid | | CAS: | 63485-51-8 | | MF: | C6H10O3 | | MW: | 130.14 | | EINECS: | | | Product Categories: | | | Mol File: | 63485-51-8.mol |  |
| | trans-Methyl 3-hydroxycyclobutanecarboxylate Chemical Properties |
| Boiling point | 190.2±33.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 14.73±0.40(Predicted) | | form | liquid | | color | Pale yellow | | InChI | InChI=1S/C6H10O3/c1-9-6(8)4-2-5(7)3-4/h4-5,7H,2-3H2,1H3/t4-,5- | | InChIKey | BYKHAEUVLSBWSU-URHBZAFASA-N | | SMILES | [C@@H]1(C(OC)=O)C[C@@H](O)C1 |
| | trans-Methyl 3-hydroxycyclobutanecarboxylate Usage And Synthesis |
| Appearance | Light yellow liquid | | Uses | Trans-methyl 3-hydroxycyclobutanecarboxylate is used as Laboratory chemicals, manufacture of substances. | | Health Hazard | Causes skin irritation;Causes serious eye irritation;May cause respiratory irritation. |
| | trans-Methyl 3-hydroxycyclobutanecarboxylate Preparation Products And Raw materials |
|