|  | |  |  | 1,2-Dianilinoethane Basic information | 
 | Product Name: | 1,2-Dianilinoethane |  | Synonyms: | n,n’-diphenyl-ethylenediamin;N,N'-Difenylethylendiamin;N,N'-Diphenyl-1,2-ethylenediamine;N,N'-Diphenyl-alpha,omega-diaminoethane;NODX;Stabilite;sym-Diphenylethylenediamine;N,N-Diphenylethylenediamine~Wanzlicks |  | CAS: | 150-61-8 |  | MF: | C14H16N2 |  | MW: | 212.29 |  | EINECS: | 205-765-6 |  | Product Categories: |  |  | Mol File: | 150-61-8.mol |  |  | 
|  |  | 1,2-Dianilinoethane Chemical Properties | 
 | Melting point | 65-67 °C(lit.) |  | Boiling point | 228°C 12mm |  | density | 1.0799 (rough estimate) |  | refractive index | 1.6000 (estimate) |  | Fp | 228°C/12mm |  | form | powder to crystal |  | pka | 4.67±0.50(Predicted) |  | color | White to Light yellow to Light red |  | Water Solubility | Sparingly soluble in water 0.072 g/L @ 25°C. |  | Merck | 14,2990 |  | BRN | 646740 |  | InChI | InChI=1S/C14H16N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |  | InChIKey | NOUUUQMKVOUUNR-UHFFFAOYSA-N |  | SMILES | C(NC1=CC=CC=C1)CNC1=CC=CC=C1 |  | CAS DataBase Reference | 150-61-8(CAS DataBase Reference) |  | EPA Substance Registry System | N,N'-Diphenylethylenediamine (150-61-8) | 
| Hazard Codes | Xi |  | Risk Statements | 36/37/38 |  | Safety Statements | 26-36 |  | WGK Germany | 3 |  | RTECS | KV4800000 |  | F | 34 |  | TSCA | Yes |  | HS Code | 29214200 | 
|  |  | 1,2-Dianilinoethane Usage And Synthesis | 
 | Chemical Properties | BEIGE TO LIGHT BROWN CRYSTALLINE POWDER |  | Uses | 1,2-Dianilinoethane can forms crystalline imidazolidines with aldehydes in the presence of AcOH. N-donating ligand. Can be used as a trapping agent for aldehydes. |  | Application | N,N′-Diphenylethylenediamine can be used: To prepare nickel(II) chelates to study their chemical reactivities.
 To prepare N-heterocyclic carbene (NHC) adducts by reacting with substituted benzaldehydes.
 As a starting material to prepare substituted cyclic poly(methyl methacrylate)s.
 |  | Synthesis Reference(s) | Synthetic Communications, 22, p. 1081, 1992 DOI: 10.1080/00397919208019300 |  | Purification Methods | Crystallise the reagent from aqueous EtOH or MeOH. [Beilstein 12 H 543, 12 IV 986.] | 
|  |  | 1,2-Dianilinoethane Preparation Products And Raw materials | 
 |