|  | |  |  | 2,2'-DIBROMOBIPHENYL Basic information | 
|  |  | 2,2'-DIBROMOBIPHENYL Chemical Properties | 
 | Melting point | 79-83 °C |  | Boiling point | 332.9±17.0 °C(Predicted) |  | density | 1.667 |  | vapor pressure | 0.007-0.27Pa at 20-50℃ |  | storage temp. | Sealed in dry,Room Temperature |  | solubility | Acetone (Sparingly), Benzene (Sparingly), Ethyl Acetate (Slightly) |  | form | Crystalline Powder |  | color | White |  | Water Solubility | Insoluble in water. |  | InChI | InChI=1S/C12H8Br2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |  | InChIKey | DRKHIWKXLZCAKP-UHFFFAOYSA-N |  | SMILES | C1(C2=CC=CC=C2Br)=CC=CC=C1Br |  | LogP | 4.6 at 25℃ and pH6.2 |  | CAS DataBase Reference | 13029-09-9(CAS DataBase Reference) |  | EPA Substance Registry System | 1,1'-Biphenyl, 2,2'-dibromo- (13029-09-9) | 
|  |  | 2,2'-DIBROMOBIPHENYL Usage And Synthesis | 
 | Chemical Properties | white crystalline powder |  | Uses | 2,2'-Dibromobiphenyl is used to produce 5,5-dimethyl-5H-dibenzosilole at the temperature of -78 - 20°C. It will need reagent n-BuLi and solvents diethyl ether, hexane. | 
|  |  | 2,2'-DIBROMOBIPHENYL Preparation Products And Raw materials | 
 |