|
| | 1-Butyl-3-methylimidazolium chloride Basic information |
| | 1-Butyl-3-methylimidazolium chloride Chemical Properties |
| Melting point | ~70 °C | | density | d25 1.08 (dried) | | Fp | 192 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Sparingly) | | form | Mass | | color | Cream to yellow | | Water Solubility | Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, | | Sensitive | Hygroscopic | | BRN | 6449277 | | Stability: | hygroscopic | | InChI | InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 | | InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M | | SMILES | N1(CCCC)C=C[N+](C)=C1.[Cl-] | | CAS DataBase Reference | 79917-90-1(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Imidazolium, 3-butyl-1-methyl-, chloride (1:1) (79917-90-1) |
| | 1-Butyl-3-methylimidazolium chloride Usage And Synthesis |
| Chemical Properties | cream-colored to yellow mass | | Uses | 1-Butyl-3-methylimidazolium chloride can be used as a precursor for the preparation of other ionic liquids by anion metathesis. | | Uses | 1-Butyl-3-methylimidazolium chloride in combination with aluminium chloride forms an organoaluminate molten salt, which can act as an acidic catalyst for the alkylation of isobutane with 2-butene. | | General Description | 1-Butyl-3-methylimidazolium chloride is an imidazolium based ionic liquid. |
| | 1-Butyl-3-methylimidazolium chloride Preparation Products And Raw materials |
|
