|  | |  |  | 1,4-Bis(hydroxydimethylsilyl)benzene Basic information | 
|  |  | 1,4-Bis(hydroxydimethylsilyl)benzene Chemical Properties | 
 | Melting point | 133-136 °C(lit.) |  | Boiling point | 289.6±36.0 °C(Predicted) |  | density | 1.02±0.1 g/cm3(Predicted) |  | Fp | >110°C |  | storage temp. | 2-8°C |  | pka | 13.91±0.53(Predicted) |  | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |  | InChI | InChI=1S/C10H18O2Si2/c1-13(2,11)9-5-7-10(8-6-9)14(3,4)12/h5-8,11-12H,1-4H3 |  | InChIKey | YBNBOGKRCOCJHH-UHFFFAOYSA-N |  | SMILES | C1([Si](C)(C)O)=CC=C([Si](C)(C)O)C=C1 |  | CAS DataBase Reference | 2754-32-7(CAS DataBase Reference) |  | EPA Substance Registry System | Silanol, 1,4-phenylenebis[dimethyl- (2754-32-7) | 
|  |  | 1,4-Bis(hydroxydimethylsilyl)benzene Usage And Synthesis | 
|  |  | 1,4-Bis(hydroxydimethylsilyl)benzene Preparation Products And Raw materials | 
 |