|
| | PT-141 Acetate Basic information |
| Product Name: | PT-141 Acetate | | Synonyms: | PT 141;VALIDAMINE;6-amino-4-(hydroxymethyl)-4-cyclohexane-[4h,5h]-1,2,3-triol;(1R,2S,3S,4S,6R)-4-Amino-6-(hydroxymethyl)cyclohexane-1,2,3-triol;PT141 acetate (Bremelanotide);[(3S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl]ammonium;Pt141 Acetate;Bremelanotide, PT141, Acetate | | CAS: | 32780-32-8 | | MF: | C7H15NO4 | | MW: | 177.2 | | EINECS: | | | Product Categories: | Peptide;Amino Acid Derivatives | | Mol File: | 32780-32-8.mol |  |
| | PT-141 Acetate Chemical Properties |
| Boiling point | 345.6±42.0 °C(Predicted) | | density | 1.434±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 13.92±0.70(Predicted) | | InChI | InChI=1S/C7H15NO4/c8-4-1-3(2-9)5(10)7(12)6(4)11/h3-7,9-12H,1-2,8H2/t3-,4+,5-,6+,7+/m1/s1 | | InChIKey | GSQYAWMREAXBHF-UOYQFSTFSA-N | | SMILES | [C@H]1(N)C[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | | CAS DataBase Reference | 32780-32-8(CAS DataBase Reference) |
| | PT-141 Acetate Usage And Synthesis |
| Uses | Validamine is a glycosidase inhibitor, and are important medicinal intermediates for synthesizing other enzyme inhibitor type hypoglycemic agents. Inhibitor of small intestinal sucrase. | | Uses | Validamine is a glycosidase inhibitors, an are important medicinal intermediates for synthesizing other enzyme inhibitor type hypoglycemic agents. Inhibitor of small intestinal sucrase. | | Definition | ChEBI: An amino cyclitol consisting of 1D-chiro-inositol lacking the 6-hydroxy group and having those at positions 1 and 5 replaced by amino and hydroxymethyl groups respectively. |
| | PT-141 Acetate Preparation Products And Raw materials |
|
