|
| | beta-D-Ribofuranose 1,2,3,5-tetraacetate Basic information |
| Product Name: | beta-D-Ribofuranose 1,2,3,5-tetraacetate | | Synonyms: | -D-RIBOFURANOSE 1,2,3,5-TETRAACETATE;β-D-Ribo;1,2,3,5-Tetraacetylribofuranose;D-Ribose tetraacetate;Tetraacetyl-β-D-ribofuranose;beta-D-Ribofuranose 1,2,3,5-tetraacetate, 98+%;á-d-ribofuranose 1,2,3,5-tetraacetate;β-d-ribofuranose 1,2,3,5-tetra-o-acetate | | CAS: | 13035-61-5 | | MF: | C13H18O9 | | MW: | 318.28 | | EINECS: | 235-898-5 | | Product Categories: | Nucleic acids;Pharmaceutical Intermediates;Sugars, Carbohydrates & Glucosides;Biochemistry;Nucleosides, Nucleotides & Related Reagents;O-Substituted Sugars;Ribose;Riboses and 2'-Deoxyriboses;Sugars;Carbohydrates & Derivatives;Intermediates & Fine Chemicals;Pharmaceuticals;13035-61-5;Glycon Biochem | | Mol File: | 13035-61-5.mol |  |
| | beta-D-Ribofuranose 1,2,3,5-tetraacetate Chemical Properties |
| Melting point | 81-83 °C(lit.) | | alpha | -15.4 º (c=7, MeOH) | | Boiling point | 417.45°C (rough estimate) | | density | 1.4171 (rough estimate) | | refractive index | -14.5 ° (C=5, MeOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Crystalline Powder | | color | White to almost white | | optical activity | [α]26/D 11.4°, c = 10 in chloroform | | BRN | 94078 | | InChI | InChI=1/C13H18O9/c1-6(14)18-5-10-11(19-7(2)15)12(20-8(3)16)13(22-10)21-9(4)17/h10-13H,5H2,1-4H3/t10-,11-,12-,13-/s3 | | InChIKey | TTXVPMATRDJQIA-BKUVIOGVSA-N | | SMILES | [C@@H]1(OC(=O)C)[C@@H](COC(=O)C)O[C@@H](OC(=O)C)[C@@H]1OC(=O)C |&1:0,5,12,17,r| | | CAS DataBase Reference | 13035-61-5(CAS DataBase Reference) |
| | beta-D-Ribofuranose 1,2,3,5-tetraacetate Usage And Synthesis |
| Chemical Properties | beta-D-Ribofuranose 1,2,3,5-tetraacetate is white to almost white crystalline powder
| | Uses | Used in the synthesis of 3-(β-D-ribofuranosyl)-2,3-dihydro-6H-1,3-oxazine-2,6-dione, a new pyrimidine nucleoside analog related to uridine. | | Uses | beta-D-Ribofuranose 1,2,3,5-tetraacetate is used in the synthesis of 3-(β-D-ribofuranosyl)-2,3-dihydro-6H-1,3-oxazine-2,6-dione, a new pyrimidine nucleoside analog related to uridine.
|
| | beta-D-Ribofuranose 1,2,3,5-tetraacetate Preparation Products And Raw materials |
|
