|
| | (S)-Pro-xylane Basic information |
| Product Name: | (S)-Pro-xylane | | Synonyms: | (S)-Pro-xylane (Synonyms: (S)-Hydroxypropyl tetrahydropyrantriol);(S)-Pro-xylane;L-glycero-L-gluco-Octitol, 1,5-anhydro-6,8-dideoxy-;βS2018;(S)-Pro xylane,Hydroxypropyl tetrahydropyrantriol;(S)-Hydroxypropyl tetrahydropyrantriol;Hydroxypropyl tetrahydropyranetriol;Xylose Impurity 14 | | CAS: | 868156-46-1 | | MF: | C8H16O5 | | MW: | 192.21 | | EINECS: | 456-880-5 | | Product Categories: | 868156-46-1 | | Mol File: | 868156-46-1.mol |  |
| | (S)-Pro-xylane Chemical Properties |
| Boiling point | 376.0±42.0 °C(Predicted) | | density | 1.368±0.06 g/cm3(Predicted) | | storage temp. | 4°C, away from moisture and light | | solubility | DMSO: 250 mg/mL (1300.66 mM) | | pka | 13.55±0.70(Predicted) | | InChI | InChI=1/C8H16O5/c1-4(9)2-6-8(12)7(11)5(10)3-13-6/h4-12H,2-3H2,1H3/t4-,5+,6-,7-,8-/s3 | | InChIKey | KOGFZZYPPGQZFZ-FHYXRTTRNA-N | | SMILES | C([C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)[C@@H](O)C |&1:1,4,6,8,10,r| |
| | (S)-Pro-xylane Usage And Synthesis |
| Description | (S)-Pro-xylane is the S-enantiomer of Pro-xylane. Pro-xylane, a biologically active C-glycoside in aqueous media, acts as an activator of glycosaminoglycans (GAGs) biosynthesis. | | Synthesis | In the autoclave, add 461g of intermediate 2,5 liters of isopropanol sequentially, seal the autoclave, replace the nitrogen 3 times, hydrogen displace 1 time, and then dissolve the catalyst [RuCl(cymene)(S-BINAP)] Cl (300mg) in 300mL of isopropanol solution underH2atmosphere, carefully add it to the autoclave, continue to fill hydrogen to 50kgf/cm2, and then heat up to about 60 °C, After stirring the reaction for 6h, stop the reaction, remove the material, and cool down the crystals to obtain βS-type Boseine products.The final product (S)-Pro-xylane can be obtained. |
| | (S)-Pro-xylane Preparation Products And Raw materials |
|
