|
| | MEGLUMINE DIATRIZOATE Basic information |
| Product Name: | MEGLUMINE DIATRIZOATE | | Synonyms: | cardiografin;d-;d-glucitol,1-deoxy-1-(methylamino)-,3,5-bis(acetylamino)-2,4,6-triiodobenzo;diatrizoatemethylglucamine;gastrografin;glucitol,1-deoxy-1-(methylamino)-,3,5-diacetamido-2,4,6-triiodobenzoate(salt;hypaque13.4;hypaque60 | | CAS: | 131-49-7 | | MF: | C18H26I3N3O9 | | MW: | 809.13 | | EINECS: | 205-024-7 | | Product Categories: | Organics;Cell Separation (Centrifugation) Media;Hematology and Histology;amino acid | | Mol File: | 131-49-7.mol |  |
| | MEGLUMINE DIATRIZOATE Chemical Properties |
| Melting point | 189-193° (dec) | | density | 1.9465 (estimate) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | Rhombic needles | | Odor | sltly sweet taste | | InChIKey | MIKKOBKEXMRYFQ-KUAVVOKVNA-N | | SMILES | N(C1C(=C(NC(=O)C)C(I)=C(C(=O)O)C=1I)I)C(=O)C.[C@@H](O)([C@@H](O)CNC)[C@H](O)[C@H](O)CO |&1:20,22,27,29,r| | | EPA Substance Registry System | D-Glucitol, 1-deoxy-1-(methylamino)-, 3,5-bis(acetylamino)-2,4,6-triiodobenzoate (salt) (131-49-7) |
| WGK Germany | 3 | | RTECS | LZ4315000 | | Toxicity | TDLo scu-man: 214 mg/kg 34ZIAG -,392,69 |
| | MEGLUMINE DIATRIZOATE Usage And Synthesis |
| Chemical Properties | Available in solution for injection, pH
between 6.0–7.6. | | Uses | Medicine (radiopaque medium). | | Uses | Meglumine diatrizoate can be used to treat long-term Taenia saginata infection. It has also been used to tag fecal matter and bodily fluids in a study investigating preoperative examination techniques in patients with acute colon obstruction caused by colorectal cancer. | | Definition | ChEBI: The N-methylglucamine salt of amidotrizoic acid. Both the sodium and the meglumine salts of amidotrizoic acid have been widely used as water-soluble radioopaque media in diagnostic radiography. The use of a mixture of the two salts is of
en preferred, as adverse effects can be reduced. | | Brand name | Angiovist (Berlex);
Cardiografin (Bracco); Cystografin (Bracco); Hypaque
(GE Healthcare); Reno (Bracco); Urovist (Berlex). | | Safety Profile | Poison by intracerebral route.Human systemic effects by subcutaneous route: kidneydamage and reduced urine volume. When heated todecomposition it emits toxic fumes of I?? and NOx. |
| | MEGLUMINE DIATRIZOATE Preparation Products And Raw materials |
|
