|
| | 8-Anilino-1-naphthalenesulfonic acid magnesium salt Basic information |
| Product Name: | 8-Anilino-1-naphthalenesulfonic acid magnesium salt | | Synonyms: | Magnesium 8-anilinonaphthalene-1-sulfonate 8-(phenylamino)naphthalene-1-sulfonate;Bis(8-anilino-1-naphthalenesulfonic acid)magnesium salt;Bis(8-anilinonaphthalene-1-sulfonic acid) magnesium salt;Bis[8-(phenylamino)-1-naphthalenesulfonic acid]magnesium salt;8-Anilino-1-naphthalenesulfonic acid magnesium salt,95%;ANS-Mg (=Magnesium 8-Anilino-1-naphthalenesulfonate);ANS-Mg (=Magnesium 8-Anilino-1-naphthalenesulfonate) [Hydrophobic fluorescent probe];1,8-ANS magnesium salt, ANSA magnesium salt, Magnesium 8-anilino-1-naphthalenesulfonate hydrate, N-Phenyl peri acid magnesium salt | | CAS: | 18108-68-4 | | MF: | C32H24MgN2O6S2 | | MW: | 620.98 | | EINECS: | 242-004-7 | | Product Categories: | Typical Metal Compounds;Mg (Magnesium) Compounds;Classes of Metal Compounds | | Mol File: | 18108-68-4.mol |  |
| | 8-Anilino-1-naphthalenesulfonic acid magnesium salt Chemical Properties |
| Melting point | >202°C (dec.) | | storage temp. | room temp | | solubility | H2O: soluble50mg/mL | | form | powder | | color | yellow to green | | BRN | 4834623 | | Stability: | Hygroscopic | | InChI | InChI=1S/2C16H13NO3S.Mg/c2*18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13;/h2*1-11,17H,(H,18,19,20);/q;;+2/p-2 | | InChIKey | IRKGXNAZPUOEMW-UHFFFAOYSA-L | | SMILES | C12C(=CC=CC=1NC1C=CC=CC=1)C=CC=C2S([O-])(=O)=O.C12C(=CC=CC=1NC1=CC=CC=C1)C=CC=C2S([O-])(=O)=O.[Mg+2] | | CAS DataBase Reference | 18108-68-4(CAS DataBase Reference) | | EPA Substance Registry System | 1-Naphthalenesulfonic acid, 8-(phenylamino)-, magnesium salt (2:1) (18108-68-4) |
| | 8-Anilino-1-naphthalenesulfonic acid magnesium salt Usage And Synthesis |
| Chemical Properties | green crystalline powder | | Uses | 8-Anilino-1-naphthalenesulfonic Acid Hemimagnesium Salt can be used as catalyst use and in engineered or chemical process of sustainable and scalable synthesis of piperylene sulfone as polymerization inhibitor. Dyes and metabolites. | | General Description | ANSA (8-Anilino-1-naphthalenesulfonic acid) is a hydrophobic polarity sensitive fluorescent dye useful as a site probe to detect conformational changes in cell and micelle membranes and molecules such as proteins. ANSA is also used as a fluorescent probe for the estimation of the critical micelle concentration (CMC) of surfactants. |
| | 8-Anilino-1-naphthalenesulfonic acid magnesium salt Preparation Products And Raw materials |
|
