|
| | Fmoc-Asn(Trt)-OH Basic information |
| | Fmoc-Asn(Trt)-OH Chemical Properties |
| Melting point | 201-204 °C(lit.) | | alpha | -16 º (c=1, MeOH) | | Boiling point | 858.1±65.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | refractive index | -19 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | <0.00005g/l | | pka | 3.79±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | optical activity | [α]20/D 15.0±1°, c = 1% in methanol | | BRN | 4343823 | | InChIKey | KJYAFJQCGPUXJY-UUWRZZSWSA-N | | SMILES | C(O)(=O)[C@H](CC(N)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 132388-59-1(CAS DataBase Reference) |
| Risk Statements | 53 | | Safety Statements | 24/25-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | F | 3-10 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |
| | Fmoc-Asn(Trt)-OH Usage And Synthesis |
| Description | Fmoc-Asn(Trt)-OH prevents the possibility of the amide side chain from undergoing dehydration side reactions during activation, especially with carbodiimide reagents. Fmoc-Asn(Trt)-OH dissolves readily in all standard peptide synthesis reagents, while Fmoc-Asn-OH is only somewhat soluble in NMP or DMF. The trityl group is removed with TFA. This reaction is usually complete within 1 hour at room temperature, but is slower when the Asn(Trt) residue in at the N-terminal of the peptide. In these cases, the deprotection reaction should be extended to 2 hours. | | Chemical Properties | white crystal powde | | Uses | Fmoc-Asn(Trt)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | Preparation | Synthesis of Fmoc-Asn(Trt)-OH:
Step 1: Crystallization to form N'-Trityl-L-asparagine crystals.
Step 2: Centrifugation to extract N'-Trityl-L-asparagine crystals.
Step 3: Washing to remove residual starting materials in the synthesis.
Step 4: Extraction to obtain N-Acetyl-L-asparagine.
Step 5: Centrifugation to extract N'-Trityl-L-asparagine.
Step 6: Drying to obtain the final product.
This synthesis method effectively removes residual synthetic materials such as trifluoroacetic acid, maleic anhydride, and epichlorohydrin, which are similar in chemical properties to N-Acetyl-L-asparagine, from the product during the production process. The purification method is simple and the product obtained has high purity. |
| | Fmoc-Asn(Trt)-OH Preparation Products And Raw materials |
|
