|
| | L-(+)-Isoleucinol Basic information |
| | L-(+)-Isoleucinol Chemical Properties |
| Melting point | 36-39 °C(lit.) | | alpha | 4.5 º (c=1.6, EtOH) | | Boiling point | 97 °C14 mm Hg(lit.) | | density | 0.9490 (rough estimate) | | refractive index | n20/D 1.4589(lit.) | | Fp | 213 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 12.88±0.10(Predicted) | | form | Viscous Liquid | | color | White to light yellow | | optical activity | [α]20/D +4.0°, c = 1.6 in ethanol | | InChI | InChI=1S/C6H15NO/c1-3-5(2)6(7)4-8/h5-6,8H,3-4,7H2,1-2H3/t5-,6+/m0/s1 | | InChIKey | VTQHAQXFSHDMHT-NTSWFWBYSA-N | | SMILES | C(O)[C@@H](N)[C@@H](C)CC | | CAS DataBase Reference | 24629-25-2(CAS DataBase Reference) | | NIST Chemistry Reference | (S)-(+)-Isoleucinol(24629-25-2) |
| | L-(+)-Isoleucinol Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline solid or |
| | L-(+)-Isoleucinol Preparation Products And Raw materials |
|