|
| | 2,4-Dichloro-5-trifluoromethylpyrimidine Basic information |
| Product Name: | 2,4-Dichloro-5-trifluoromethylpyrimidine | | Synonyms: | 2,4-DICHLORO-5-(TRIFLUOROMETHYL)PYRIMIDINE;5-TRIFLUOROMETHYL-2,4-DICHLOROPYRIMIDINE;4-(broMoMethyl)-3-chlorobenzaMide;2,4-Dichloro-5-(trifluoromethyl)-1,3-diazine;2,4-Dichloro-5-(trifluoroMethyl)pyriMidine 97%;2,4-Dichloro-5-(trifluoroMethyl);PyriMidine, 2,4-dichloro-5-(trifluoroMethyl)-;2,4-Dichloro-5-trifl | | CAS: | 3932-97-6 | | MF: | C5HCl2F3N2 | | MW: | 216.98 | | EINECS: | 609-648-4 | | Product Categories: | Pyrazoles;Fluorine series;pharmacetical;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyrimidines;Pyrimidine;Building Blocks;Halogenated;3932-97-6 | | Mol File: | 3932-97-6.mol |  |
| | 2,4-Dichloro-5-trifluoromethylpyrimidine Chemical Properties |
| Boiling point | 49℃/32mm | | density | 1.609 g/mL at 25 °C | | refractive index | 1.4749 | | Fp | 200 ºF | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Clear Colorless to Pale Yellow Liquid | | pka | -4.89±0.29(Predicted) | | InChI | InChI=1S/C5HCl2F3N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H | | InChIKey | VABVSVZAESMOCH-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C(Cl)=N1 | | CAS DataBase Reference | 3932-97-6(CAS DataBase Reference) |
| Hazard Codes | Xi,C,T | | Risk Statements | 36/37/38-36-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | CORROSIVE | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 29335990 |
| | 2,4-Dichloro-5-trifluoromethylpyrimidine Usage And Synthesis |
| Chemical Properties | White liquid or solid | | Uses | 2,4-Dichloro-5-trifluoromethylpyrimidine is a reactant in the preparation of pyrimidine derivatives as inhibitors of gene ALK protein Kinase phosphorylating kinase and as cell proliferation inhibitors. |
| | 2,4-Dichloro-5-trifluoromethylpyrimidine Preparation Products And Raw materials |
|
