|  | |  |  | 1,3-Bis(diphenylphosphino)propane Basic information | 
|  |  | 1,3-Bis(diphenylphosphino)propane Chemical Properties | 
 | Melting point | 63-65 °C (lit.) |  | Boiling point | 529.7±33.0 °C(Predicted) |  | Fp | 235°C |  | storage temp. | Inert atmosphere,Room Temperature |  | form | Granules or Powder |  | color | White to light yellow-beige |  | Water Solubility | insoluble |  | Sensitive | Air Sensitive |  | BRN | 2821785 |  | InChI | InChI=1S/C27H26P2/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27/h1-12,14-21H,13,22-23H2 |  | InChIKey | LVEYOSJUKRVCCF-UHFFFAOYSA-N |  | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)CCCP(C1C=CC=CC=1)C1C=CC=CC=1 |  | CAS DataBase Reference | 6737-42-4(CAS DataBase Reference) |  | NIST Chemistry Reference | 1,3-Bis(diphenylphosphino)propane(6737-42-4) |  | EPA Substance Registry System | Phosphine, 1,3-propanediylbis[diphenyl- (6737-42-4) | 
|  |  | 1,3-Bis(diphenylphosphino)propane Usage And Synthesis | 
 | Chemical Properties | white to light yellow crystal powde |  | Uses | 1,3-Bis(diphenylphosphino)propane is used as a bidentate ligand in coordination chemistry and form complex dichloro(1,3-bis(diphenylphosphino)propane)nickel by reacting with nickel(II) chloride. This complex is used as a catalyst for Kumada coupling reaction. It also acts as a ligand for palladium(II) catalysts which is useful for the co-polymerization of carbon monoxide and ethylene to get polyketones. Further, it is employed in palladium-catalyzed arylation under Heck reaction and Suzuki reaction. In addition to this, it serves as a catalyst for Negishi coupling and Sonogashira coupling reactions. | 
|  |  | 1,3-Bis(diphenylphosphino)propane Preparation Products And Raw materials | 
 |