|
| Product Name: | Isocitric acid trisodium salt | | Synonyms: | DL-Isocitrate trisodium salt(anhydrous);THREO-DSLS-ISOCITRIC ACID TRISODIUM SALT;TRISODIUM(+/-)-ISOCITRATE N-HYDRATE;TRISODIUM DL-ISOCITRATE;DL-ISOCITRIC ACID NA3-SALT;trisodium hydrogen 3-carboxylato-2,3-dideoxy-1-hydroxypropane-1,2,3-tricarboxylate;Isocitric acid trisodium salt;Trisodium 1-hydroxypropane-1,2,3-tricarboxylate | | CAS: | 1637-73-6 | | MF: | C6H9NaO7 | | MW: | 216.12 | | EINECS: | 216-668-3 | | Product Categories: | | | Mol File: | 1637-73-6.mol |  |
| | Isocitric acid trisodium salt Chemical Properties |
| Melting point | >300*C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water (Slightly) | | form | Crystalline Powder | | color | White to almost white | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H8O7.Na.H/c7-3(8)1-2(5(10)11)4(9)6(12)13;;/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13);; | | InChIKey | PXOCFRDZUIKIIE-UHFFFAOYSA-N | | SMILES | C(C(=O)O)(CC(=O)O)C(O)C(=O)O.[NaH] | | CAS DataBase Reference | 1637-73-6(CAS DataBase Reference) |
| | Isocitric acid trisodium salt Usage And Synthesis |
| Description | DL-isocitric acid trisodium is the trisodium salt of isocitric acid. Isocitric acid is the isomer of citric acid. The isocitric acid is an important substrate in the central metabolic pathway, citric acid cycle (TCA cycle) inside organisms. Since it is an organic acid found in most fruit juices, it is commonly used as a marker to evaluate the authenticity and quality of fruit products, most often citrus juices in food industry.
| | Sources | https://en.wikipedia.org/wiki/Isocitric_acid
https://secure.megazyme.com/files/Booklet/K-ISOC_DATA.pdf
| | Chemical Properties | white to almost white crystalline powder | | Uses | Isocitric acid is the protonated analogue of isocitrate, a substrate of the citric acid cycle. | | Definition | ChEBI: Isocitric acid, DL- is a carbonyl compound. |
| | Isocitric acid trisodium salt Preparation Products And Raw materials |
|
