|
| | 3-(Trifluoromethyl)phenylacetone Basic information |
| | 3-(Trifluoromethyl)phenylacetone Chemical Properties |
| Boiling point | 89-90 °C0.5 mm Hg(lit.) | | density | 1.204 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.457(lit.) | | Fp | 192 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | clear liquid | | Specific Gravity | 1.204 | | color | Light yellow to Amber to Dark green | | InChI | InChI=1S/C10H9F3O/c1-7(14)5-8-3-2-4-9(6-8)10(11,12)13/h2-4,6H,5H2,1H3 | | InChIKey | JPHQCDCEBDRIOL-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(C(F)(F)F)=C1)C(=O)C | | CAS DataBase Reference | 21906-39-8(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Propanone, 1-[3-(trifluoromethyl)phenyl]-(21906-39-8) |
| | 3-(Trifluoromethyl)phenylacetone Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID | | Uses | 3-(Trifluoromethyl)phenylacetone was used in the synthesis of:
- (±)-[1-(3-trifluoromethyl)phenyl]-2-propylamine via reductive amination reaction
- N-{2-[1-methyl-2-(3-trifluoromethylphenyl]}-aminoethanol
| | Synthesis Reference(s) | The Journal of Organic Chemistry, 61, p. 1748, 1996 DOI: 10.1021/jo9518314
Synthesis, p. 474, 1977 |
| | 3-(Trifluoromethyl)phenylacetone Preparation Products And Raw materials |
|
