|
| | 2,3-Dichloropyridine Basic information |
| Product Name: | 2,3-Dichloropyridine | | Synonyms: | 2,3-dichloro-pyridin;2,3-dichloropyridine analogue;2,3-DICHLOROPYRIDINE;2,3-Dichloropyridine147.99;2,3-Dichloropyridine,99%;2,3-DICHLOROPYRIDINE 2,3-DICHLOROPYRIDINE;2,3-dichloropydine;2,3-Dichloropyridine ,98% | | CAS: | 2402-77-9 | | MF: | C5H3Cl2N | | MW: | 147.99 | | EINECS: | 219-281-8 | | Product Categories: | Pyridines, Pyrimidines, Purines and Pteredines;Pyridine series;Chloropyridines;Halopyridines;Boronic Acid;C5Heterocyclic Building Blocks;blocks;Pyridines;Pyridine;Halides;Heterocycles;Pyridines derivates;Halogenated Heterocycles;Heterocyclic Building Blocks;Chlorinated heterocyclic series;alkyl chloride;bc0001 | | Mol File: | 2402-77-9.mol |  |
| | 2,3-Dichloropyridine Chemical Properties |
| Melting point | 64-67 °C (lit.) | | Boiling point | 242.42°C (rough estimate) | | density | 1.5159 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | pka | -0.63±0.10(Predicted) | | color | White to slightly beige | | Water Solubility | slightly soluble | | BRN | 109811 | | InChI | InChI=1S/C5H3Cl2N/c6-4-2-1-3-8-5(4)7/h1-3H | | InChIKey | MAKFMOSBBNKPMS-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC=C1Cl | | CAS DataBase Reference | 2402-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | RIDADR | UN2811 | | WGK Germany | 3 | | RTECS | US8050000 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29333999 |
| | 2,3-Dichloropyridine Usage And Synthesis |
| Chemical Properties | White to slightly beige crystalline powder | | Uses | 2,3-Dichloropyridine is used as a reagent for the preparation of substituted 3-(5-membered heterocycle-carboxamido)pyridine derivatives for treatment of autoimmune and inflammatory diseases. Also in the synthesis, crystal structure and biological activity of novel anthranilic Diamide insecticide with propargyl ether.
| | Synthesis |
2,3-dichloropyridine is synthesized from 2-chloronicotinic acid via amidation, Hofmann degradation, diazotization and Sandmeyer reaction.
|
| | 2,3-Dichloropyridine Preparation Products And Raw materials |
|