|
| Product Name: | POPSO | | Synonyms: | 1,4-Piperazinebis(2-hydroxy-1-propanesulfonic acid);3,3'-(1,4-Piperazinediyl)bis(2-hydroxy-1-propanesulfonic acid);3,3'-(Piperazine-1,4-diyl)bis(2-hydroxypropane-1-sulfonic acid);β,β'-Dihydroxy-1,4-piperazinedi(1-propanesulfonic acid);POPSO (Piperazine-1,4-bis(2-hydroxypropanesulfonic acid)dihydrat;β,β'-dihydroxypiperazine-1,4-dipropanesulphonic acid;Piperazine-1,4-bis(2-hydroxypropanesulfonic Acid) Dihydrate [Good's buffer component for biological research];POPSO hydrate ,99% | | CAS: | 68189-43-5 | | MF: | C10H22N2O8S2 | | MW: | 362.42 | | EINECS: | 269-199-1 | | Product Categories: | Buffer;Biochemistry;Good's Buffers | | Mol File: | 68189-43-5.mol |  |
| | POPSO Chemical Properties |
| Melting point | 320°C | | density | 1.578±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 1 M NaOH: 0.1 M, clear, colorless | | form | Solid | | color | White powder | | PH Range | 7.2 - 8.5 | | pka | 7.8(at 25℃) | | BRN | 842252 | | InChI | InChI=1S/C10H22N2O8S2.2H2O/c13-9(7-21(15,16)17)5-11-1-2-12(4-3-11)6-10(14)8-22(18,19)20;;/h9-10,13-14H,1-8H2,(H,15,16,17)(H,18,19,20);2*1H2 | | InChIKey | PDSOJBZKKTTWHS-UHFFFAOYSA-N | | SMILES | S(=O)(=O)(O)CC(O)CN1CCN(CC(O)CS(=O)(=O)O)CC1.O.O | | CAS DataBase Reference | 68189-43-5(CAS DataBase Reference) | | EPA Substance Registry System | 1,4-Piperazinedipropanesulfonic acid, .beta.,.beta.'-dihydroxy- (68189-43-5) |
| | POPSO Usage And Synthesis |
| Chemical Properties | white powder |
| | POPSO Preparation Products And Raw materials |
|
