|
| | N,N-DIETHYLNICOTINAMIDE Basic information |
| | N,N-DIETHYLNICOTINAMIDE Chemical Properties |
| Melting point | 23 °C (lit.) | | Boiling point | 296-300 °C (lit.) | | density | 1.06 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.524(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | pKa 3.46(H2O,t =20) (Uncertain) | | form | Liquid | | color | Clear colorless to yellow | | Merck | 14,6543 | | BRN | 5743 | | InChI | InChI=1S/C10H14N2O/c1-3-12(4-2)10(13)9-6-5-7-11-8-9/h5-8H,3-4H2,1-2H3 | | InChIKey | NCYVXEGFNDZQCU-UHFFFAOYSA-N | | SMILES | C1=NC=CC=C1C(N(CC)CC)=O | | CAS DataBase Reference | 59-26-7(CAS DataBase Reference) | | EPA Substance Registry System | Nikethamide (59-26-7) |
| Hazard Codes | T | | Risk Statements | 25-36/37/38-23/24/25 | | Safety Statements | 26-45-36/37/39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | QS4375000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29333999 | | Toxicity | LD50 i.p. in rats: 272 mg/kg (Goldenthal) |
| | N,N-DIETHYLNICOTINAMIDE Usage And Synthesis |
| Description | A further Corydalis alkaloid, coramine has been obtained from C. pseudoadunca
M. Pop. It forms colourless needles from EtOH and is optically active with a
specific rotation of [α]D - 391 ° (c 0.2, MeOH). Both the hydrochloride, m.p.
216-9°C and the hydrobromide, m.p. 223-6°C have been described. | | Chemical Properties | clear colorless to yellow liquid | | Uses | analeptic | | Uses | N,N-Diethylnicotinamide (DENC) is commonly used as a ligand to prepare tetranuclear copper complexes. | | Definition | ChEBI: Nikethamide is a pyridinecarboxamide. It is functionally related to a nicotinamide. | | General Description | Clear light yellow viscous liquid or crystalline solid. Slightly bitter taste followed by a faint sensation of the warmth. | | Air & Water Reactions | Water soluble. | | Reactivity Profile | N,N-DIETHYLNICOTINAMIDE is incompatible with sodium carbonate solutions which cause precipitation. . | | Health Hazard | ACUTE/CHRONIC HAZARDS: When heated to decomposition N,N-DIETHYLNICOTINAMIDE emits toxic fumes. | | Fire Hazard | N,N-DIETHYLNICOTINAMIDE is combustible. | | Safety Profile | Poison by ingestion,
intravenous, intraperitoneal, and
subcutaneous routes. When heated to
decomposition it emits toxic fumes of NOx.
| | References | Yunusov, Akramov, Yunusov, Dokl. Akad. Nauk. USSR, 162,607 (1965)
Yunusov, Akramov, Yunusov, Khim. Prir. Soedin., 2, 340 (1966)
Ibragimova, Yunusov, Yunusov, ibid, 6,438 (1970)
Yunusov, et al., ibid, 7, 380 (1971) |
| | N,N-DIETHYLNICOTINAMIDE Preparation Products And Raw materials |
|