|
| | Ropivacaine hydrochloride Basic information |
| Product Name: | Ropivacaine hydrochloride | | Synonyms: | Ropivacaine hydrochloride;(2S)-N-(2,6-dimethylphenyl)-1-propyl-pipecolinamide hydrochloride;(2S)-N-(2,6-dimethylphenyl)-1-propyl-piperidine-2-carboxamide hydrochloride;(2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide hydrochloride;Ropivacaine hydrochl;ROPIVCACAINE HYDROCHLORIDE;ROPIVACAINE HCL;(S)-ROPIVACAINE HYDROCHLORIDE | | CAS: | 98717-15-8 | | MF: | C17H27ClN2O | | MW: | 310.86 | | EINECS: | 1312995-182-4 | | Product Categories: | Active Pharmaceutical Ingredients;Anesthetic (Local) | | Mol File: | 98717-15-8.mol |  |
| | Ropivacaine hydrochloride Chemical Properties |
| Melting point | 260-262° | | alpha | D25 -6.6° (c = 2 in water) | | storage temp. | Store at -20°C | | Water Solubility | ≥ 10.1mg/mL in Water | | InChI | InChI=1S/C17H26N2O.ClH/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3;/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20);1H | | InChIKey | NDNSIBYYUOEUSV-UHFFFAOYSA-N | | SMILES | N1(CCC)CCCCC1C(NC1=C(C)C=CC=C1C)=O.[H]Cl | | CAS DataBase Reference | 98717-15-8(CAS DataBase Reference) |
| | Ropivacaine hydrochloride Usage And Synthesis |
| Uses | anesthetic | | Uses | 2-Piperidinecarboxamide hydrochloride is a useful research chemical compound. | | Definition | ChEBI: The anhydrous form of (S)-ropivacaine hydrochloride. |
| | Ropivacaine hydrochloride Preparation Products And Raw materials |
|