|  | | Product Name: | N,N,N',N'-Tetramethylazodicarboxamide |  | Synonyms: | Tetramethylazodicarboxamide(TMAD);1,1μ-Azobis(N,N-dimethylformamide),  Azodicarboxylic  acid  bis(dimethylamide),  Diazinedicarboxylic  acid  bis(N,N-dimethylamide),  N,N,Nμ,Nμ-Tetramethylazodicarboxamide;Azodicarboxylic  acid  bis(dimethylamide),  diamide,  Diamide,  Diazinedicarboxylic  acid  bis(N,N-dimethylamide),  N,N,Nμ,Nμ-Tetramethylazodicarboxamide;1,1′-Azobis(N,N-dimethylformamide),  Azodicarboxylic  acid  bis(dimethylamide);Diazenedicarboxylic acid bis(N,N-dimethylamide);Formamide, 1,1'-azobis[N,N-dimethyl-;AZODICARBOXYLIC ACID BIS[DIMETHYLAMIDE];DIAZINE-DICARBOXYLIC ACID BIS[N,N-DIMETHYLAMIDE] |  | CAS: | 10465-78-8 |  | MF: | C6H12N4O2 |  | MW: | 172.19 |  | EINECS: | 233-951-7 |  | Product Categories: | proteinmod;Azodicarboxylates & Amides;Mitsunobu Reaction;Synthetic Organic Chemistry |  | Mol File: | 10465-78-8.mol |  |  | 
|  |  | N,N,N',N'-Tetramethylazodicarboxamide Chemical Properties | 
 | Melting point | 112 °C |  | Boiling point | 220.4±23.0 °C(Predicted) |  | density | 1.13±0.1 g/cm3(Predicted) |  | storage temp. | -20°C |  | solubility | soluble in Methanol |  | form | crystalline |  | pka | -0?+-.0.70(Predicted) |  | color | yellow |  | BRN | 1910409 |  | InChI | InChI=1S/C6H12N4O2/c1-9(2)5(11)7-8-6(12)10(3)4/h1-4H3/b8-7+ |  | InChIKey | VLSDXINSOMDCBK-BQYQJAHWSA-N |  | SMILES | C(=O)(/N=N/C(=O)N(C)C)N(C)C |  | CAS DataBase Reference | 10465-78-8(CAS DataBase Reference) | 
| Safety Statements | 22-24/25 |  | WGK Germany | 3 |  | RTECS | LQ1041000 |  | F | 4.10 |  | HS Code | 29270000 | 
|  |  | N,N,N',N'-Tetramethylazodicarboxamide Usage And Synthesis | 
 | Description | N,N,N’,N’-Tetramethylazodicarboxamide (also named as Diamide, TMAD) is a reagent used for the oxidization of thiols in proteins. It is used as a reagent in the Mitsunobu reaction in place of diethyl azodicarboxylate. It can be used to titrate protein gluotathiolation to discriminate from other protein modifications. |  | References | N. S. Kosower, E. M. Kosower, Diamide: A oxidant probe for this, Methods in Enzymology, 1995, vol. 251, pp. 123133 |  | Chemical Properties | Yellow crystals |  | Uses | Reported to be of use as a thiol oxidizing agent. Diamide has been used to titrate protein glutathiolation to discriminate from other oxidative protein modifications. Treatment increased protein glutathiolation in a concentration-dependent manner and had comparably little effect on protein-protein disulfide formation. |  | Definition | ChEBI: 1,1'-azobis(N,N-dimethylformamide) is a monoazo compound. |  | Synthesis Reference(s) | The Journal of Organic Chemistry, 38, p. 1652, 1973 DOI: 10.1021/jo00949a007 | 
|  |  | N,N,N',N'-Tetramethylazodicarboxamide Preparation Products And Raw materials | 
 |