|
| | 2-Methyl-3-biphenylmethanol Basic information |
| | 2-Methyl-3-biphenylmethanol Chemical Properties |
| Melting point | 73-76 °C(lit.) | | Boiling point | 330.9±11.0 °C(Predicted) | | density | 1.072±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.28±0.10(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C14H14O/c1-11-13(10-15)8-5-9-14(11)12-6-3-2-4-7-12/h2-9,15H,10H2,1H3 | | InChIKey | BGTLHJPGBIVQLJ-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC(CO)=C1C | | CAS DataBase Reference | 76350-90-8(CAS DataBase Reference) | | EPA Substance Registry System | [1,1'-Biphenyl]-3-methanol, 2-methyl- (76350-90-8) |
| WGK Germany | 3 | | HS Code | 2906290090 |
| | 2-Methyl-3-biphenylmethanol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Bifenthrin intermediate. |
| | 2-Methyl-3-biphenylmethanol Preparation Products And Raw materials |
|