|
| | 4-(Trifluoromethoxy)aniline Basic information |
| | 4-(Trifluoromethoxy)aniline Chemical Properties |
| Boiling point | 73-75 °C10 mm Hg(lit.) | | density | 1.32 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.463(lit.) | | Fp | 177 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 3.75±0.10(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.310 | | BRN | 2090209 | | Stability: | Hygroscopic | | InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4H,11H2 | | InChIKey | XUJFOSLZQITUOI-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OC(F)(F)F)C=C1 | | CAS DataBase Reference | 461-82-5(CAS DataBase Reference) |
| | 4-(Trifluoromethoxy)aniline Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW LIQUID | | Uses | 4-(Trifluoromethoxy)aniline was used in the synthesis of:
- side-group liquid-crystalline polymethacrylates with fluorine-containing mesogens
- derivatives of 3-(quinolin-3-yl)acrylates
- series of novel Shiff bases, via condensation with pyridinecarboxaldehydes in the presence of molecular sieves
| | Uses | 4-(Trifluoromethoxy)aniline is used in the synthesis of anticancer agents and antitumor medicaments. Also, its an intermediate in the production of labelled Riluzole, a neuroprotective agent. Modulates glutamatergic transmission. A glutamate release inhibitor. An anticonvulsant. |
| | 4-(Trifluoromethoxy)aniline Preparation Products And Raw materials |
|
