|
| | 4-Bromo-1-indanone Basic information | | Uses |
| | 4-Bromo-1-indanone Chemical Properties |
| Melting point | 95-99 °C(lit.) | | Boiling point | 125°C/1.5mmHg(lit.) | | density | 1.608±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | Orange-brown | | InChI | InChI=1S/C9H7BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2 | | InChIKey | UVVYFYLSZIMKMC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(Br)=CC=C2)CC1 | | CAS DataBase Reference | 15115-60-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-60-36 | | WGK Germany | 2 | | RTECS | NK7536100 | | HS Code | 29147000 |
| | 4-Bromo-1-indanone Usage And Synthesis |
| Uses | 4-Bromo-1-indanone is used to prepare N'-indanyl-N-benzopyrazolyl ureas as TRPV1 antagonists for use as analgesics. It is also used to synthesize 1,4-dihydroindeno[1,2-c]pyrazoles as KDR kinase inhibitors. | | Chemical Properties | Orange-brown crystalline powder | | Uses | 4-Bromo-1-indanone is used to prepare N''-indanyl-N-benzopyrazolyl ureas as TRPV1 antagonists for use as analgesics. It is also used to synthesize 1,4-dihydroindeno[1,2-c]pyrazoles as KDR kinase inhibitors. |
| | 4-Bromo-1-indanone Preparation Products And Raw materials |
| Raw materials | 6-Bromoindanone-->5-Bromoindanone-->4,7-Dibromo-2,3-dihydro-1H-inden-1-one-->1-Indanone | | Preparation Products | (S)-tert-butyl (4-cyano-2,3-dihydro-1H-inden-1-yl)carbamate-->4-BROMO-2,3-DIHYDRO-1H-INDEN-1-OL-->5-BROMOISOQUINOLIN-1(2H)-ONE-->2-(2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane-->2,3-dihydro-1-oxo-1H-indene-4-carbonitrile-->4-FORMYL-INDAN-1-ONE 1,2-ETHANEDIOL KETAL-->2-Allyl-5-broMo-3,4-dihydroisoquinolin-1(2H)-one-->2,3-DIHYDRO-4-METHYL-1H-INDEN-1-OL-->4-phenylindan-1-one |
|
