|
| Product Name: | TBTA | | Synonyms: | Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)Methyl]aMine 97%;1-(1-Benzyltriazol-4-yl)-N,N-bis[(1-benzyltriazol-4-yl)methyl]methanamine;N,N,N-Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]amine;Tris-(benzyltriazolylmethyl)amine;Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]amine;Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]amine, 97% TBTA;1H-1,2,3-Triazole-4-methanamine, 1-(phenylmethyl)-N,N-bis[[1-(phenylmethyl)-1H-1,2,3-triazol-4-yl]methyl]-;TBTA ISO 9001：2015 REACH | | CAS: | 510758-28-8 | | MF: | C30H30N10 | | MW: | 530.63 | | EINECS: | 693-028-3 | | Product Categories: | | | Mol File: | 510758-28-8.mol |  |
| Melting point | 132-143℃ | | Boiling point | 762.4±70.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DMF. | | pka | 2.44±0.50(Predicted) | | form | Solid | | color | White | | Stability: | store cold | | InChI | InChI=1S/C30H30N10/c1-4-10-25(11-5-1)16-38-22-28(31-34-38)19-37(20-29-23-39(35-32-29)17-26-12-6-2-7-13-26)21-30-24-40(36-33-30)18-27-14-8-3-9-15-27/h1-15,22-24H,16-21H2 | | InChIKey | WKGZJBVXZWCZQC-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)C=C(CN(CC2=CN(CC3=CC=CC=C3)N=N2)CC2=CN(CC3=CC=CC=C3)N=N2)N=N1 |
| WGK Germany | 3 | | HS Code | 2933998090 |
| Description | TBTA was introduced shortly after the copper-catalyzed azide-alkyne cycloaddition reaction was discovered to mitigate thermodynamic instability of Cu(I) in aerobic media. TBTA is a water-insoluble ligand and must be first dissolved in DMSO or DMF.
J Am Chem Soc., 143 (18), 6787-6791.
T. R. Chan, R. Hilgraf, K. B. Sharpless, V. V. Fokin, Org. Lett. 2004, 6, 2853. | | Uses | Tris-(benzyltriazolylmethyl)amine is a useful reagent for copper (I) catalyzed azide-alkyne cycloadditions.?It can also be used for postsynthetic labelling of alkyne-modified DNA. | | storage | Store at -20°C |
| | TBTA Preparation Products And Raw materials |
|
