|
| | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE Basic information |
| | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE Chemical Properties |
| Boiling point | 232℃ | | density | 1.823 | | refractive index | 1.5745-1.5765 | | Fp | 94℃ | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C6H2BrCl2F/c7-4-1-3(8)2-5(10)6(4)9/h1-2H | | InChIKey | CAYJMDVKWMVOLG-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(Cl)=CC(F)=C1Cl | | CAS DataBase Reference | 202865-57-4(CAS DataBase Reference) |
| | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid |
| | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE Preparation Products And Raw materials |
|