|
| | Trimethyloxonium Tetrafluoroborate Basic information |
| | Trimethyloxonium Tetrafluoroborate Chemical Properties |
| Melting point | 200 °C | | storage temp. | Store at +2°C to +8°C. | | solubility | Soluble in nitrobenzene, nitromethane, chloroform, hot acetone, liquid sulfur dioxide. Slightly soluble in dichloromethane. Insoluble in common organic solvents. | | form | Crystals | | color | White to off-white | | Sensitive | Moisture Sensitive | | BRN | 3597303 | | InChI | InChI=1S/C3H9O.BF4/c1-4(2)3;2-1(3,4)5/h1-3H3;/q+1;-1 | | InChIKey | JDFKFXJJAIJXPP-UHFFFAOYSA-M | | SMILES | [B-](F)(F)(F)F.[O+](C)(C)C | | CAS DataBase Reference | 420-37-1(CAS DataBase Reference) | | EPA Substance Registry System | Oxonium, trimethyl-, tetrafluoroborate(1-) (420-37-1) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-10-21 | | Hazard Note | Corrosive/Freeze | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29420000 |
| | Trimethyloxonium Tetrafluoroborate Usage And Synthesis |
| Chemical Properties | This substance is a white to off-white crystals that is prone to water sensitivity and displays a level of hygroscopicity. | | Uses | Trimethyloxonium Tetrafluoroborate is a trialkylated oxonium used as a methylation agent in organic synthesis. | | Uses | Trimethyloxonium tetrafluoroborate act as a avmethylating agent and activates C-X multiple bonds. It is involved in the esterification of polyfunctional carboxylic acids. It acts as a catalyst in the polymerization of cyclic sulfides and ethers. Further, it is used in Beckmann rearrangement of oximes. | | Uses | Reagent for the methylation of hydroxyl groups recently used in a complex, multistep synthesis directed towards spirastrellolide, a marine natural product. | | Health Hazard | Trimethyloxonium Tetrafluoroborate is a potent alkylating agent, with its non-volatile nature reducing associated hazards. Nevertheless, it produces strong acids upon contact with water, so it is important to exercise caution and prevent water contact during its application. |
| | Trimethyloxonium Tetrafluoroborate Preparation Products And Raw materials |
|