|
| | 2,5-DIMETHYL-1,5-HEXADIENE Basic information |
| Product Name: | 2,5-DIMETHYL-1,5-HEXADIENE | | Synonyms: | 2,5-dimethyl-hexa-1,5-diene;2,5-Dimethylhexa-1,5-diene;Bimethallyl;CH2=C(CH3)CH2CH2C(CH3)=CH2;NSC-10813;2,5-Dimethyl-1,5-hexadiene,98%;2,5-Dimethyl-1,5-hexandiene;2,5-Dimethyl-1,5-hexadiene,Dimethallyl | | CAS: | 627-58-7 | | MF: | C8H14 | | MW: | 110.2 | | EINECS: | 211-003-3 | | Product Categories: | Acyclic;Alkenes;Building Blocks;Chemical Synthesis;Organic Building Blocks | | Mol File: | 627-58-7.mol |  |
| | 2,5-DIMETHYL-1,5-HEXADIENE Chemical Properties |
| Melting point | −75 °C(lit.) | | Boiling point | 114 °C(lit.) | | density | 0.742 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.429(lit.) | | Fp | 45 °F | | storage temp. | Flammables area | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.742 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 1697948 | | CAS DataBase Reference | 627-58-7(CAS DataBase Reference) | | EPA Substance Registry System | 1,5-Hexadiene, 2,5-dimethyl- (627-58-7) |
| Hazard Codes | F,Xn | | Risk Statements | 11-36/37/38-65 | | Safety Statements | 16-26-36-62 | | RIDADR | UN 3295 3/PG 2 | | WGK Germany | 3 | | TSCA | Yes | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29012990 |
| | 2,5-DIMETHYL-1,5-HEXADIENE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Synthesis Reference(s) | Journal of the American Chemical Society, 106, p. 5028, 1984 DOI: 10.1021/ja00329a079
Synthesis, p. 607, 1976 DOI: 10.1055/s-1976-24136 |
| | 2,5-DIMETHYL-1,5-HEXADIENE Preparation Products And Raw materials |
| Raw materials | 2-Pentene, 4-chloro--->4,5-Dimethyl-2,6-octadiene.-->1,5-Heptadiene, 2,4-dimethyl--->3-Chloro-2-methylpropene | | Preparation Products | 2,5-DICHLORO-2,5-DIMETHYLHEXANE-->1,4-PENTADIENE-->2,5-Dimethyl-2,4-hexadiene |
|
