|
| | 5-hexylbenzene-1,3-diol Basic information |
| | 5-hexylbenzene-1,3-diol Chemical Properties |
| Boiling point | 192-195 °C | | density | 1.049±0.06 g/cm3(Predicted) | | pka | 9.77±0.11(Predicted) | | InChI | InChI=1S/C12H18O2/c1-2-3-4-5-6-10-7-11(13)9-12(14)8-10/h7-9,13-14H,2-6H2,1H3 | | InChIKey | XECRVULUEJSGBY-UHFFFAOYSA-N | | SMILES | C1(O)=CC(CCCCCC)=CC(O)=C1 |
| | 5-hexylbenzene-1,3-diol Usage And Synthesis |
| Uses | 5-Hexyl Resorcinol is a resorcinol derivative isolated from Gmelina arborea. A potential antibacterial agent | | Synthesis Reference(s) | The Journal of Organic Chemistry, 37, p. 2901, 1972 DOI: 10.1021/jo00983a025 |
| | 5-hexylbenzene-1,3-diol Preparation Products And Raw materials |
|
