|
| | Lambda Cyhalotric Acid Basic information |
| Product Name: | Lambda Cyhalotric Acid | | Synonyms: | (1R,3R)-rel-3-(2-Chloro-3,3,3-trifluoro-1-propenyl)-2,2-diMethyl-cyclopropanecarboxylic Acid;2-diMethylcyclopropane carboxylate acid;Trifluoroacetic acid ju;cis-3-[(2-Chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropanecarboxylic acid;Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid;BIFENTHRIN ACID METABOLITE;BIFENTHRIN FREE ACID METABOLITE;Cis-3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylateacid | | CAS: | 72748-35-7 | | MF: | C9H10ClF3O2 | | MW: | 242.62 | | EINECS: | 266-275-6 | | Product Categories: | Intermediates;Miscellaneous Reagents;Pesticide;3 | | Mol File: | 72748-35-7.mol |  |
| | Lambda Cyhalotric Acid Chemical Properties |
| Melting point | 107-109°C | | Boiling point | 271.6±40.0 °C(Predicted) | | density | 1.152 | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Sparingly, Sonicated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.91±0.42(Predicted) | | color | White to Off-White | | InChI | InChI=1/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15)/t4-,6-/s3 | | InChIKey | SPVZAYWHHVLPBN-BNFWCSRPNA-N | | SMILES | [C@@H]1(C(O)=O)[C@H](C=C(Cl)C(F)(F)F)C1(C)C |&1:0,4,r| | | CAS DataBase Reference | 72748-35-7(CAS DataBase Reference) |
| | Lambda Cyhalotric Acid Usage And Synthesis |
| Chemical Properties | Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid is Off-White Solid
| | Uses | Reagent used in the synthesis of cyhalothric pesticides and fungicides. | | Uses | Z-(1R,S)-cis-2,2-dimethyl-3-(2,2-chloro-3,3,3-trifluoro-1-propenyl)cyclopropanecarboxylic acid used in the synthesis of cyhalothric pesticides and fungicides.
|
| | Lambda Cyhalotric Acid Preparation Products And Raw materials |
|
