|
| | Magnesium ascorbyl phosphate Basic information |
| | Magnesium ascorbyl phosphate Chemical Properties |
| density | 1.74[at 20℃] | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 8g/100ml water (25℃) | | form | Solid | | color | White | | Water Solubility | 789g/L at 20℃ | | Stability: | Hygroscopic | | InChI | InChI=1/C6H9O9P.Mg.2H/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;;;/h2,4,7-9H,1H2,(H2,11,12,13);;;/t2-,4+;;;/s3 | | InChIKey | ACFGRWJEQJVZTM-LEJBHHMKSA-L | | SMILES | O(C1C(O[C@]([H])([C@@H](O)CO)C=1O)=O)P(O)(O)=O.[Mg] |&1:4,6,r| | | CAS DataBase Reference | 113170-55-1(CAS DataBase Reference) |
| | Magnesium ascorbyl phosphate Usage And Synthesis |
| Uses | magnesium ascorbyl phosphate (magnesium-1-ascorbyl-2phosphate) is a stabilized, synthetically derived version of vitamin C. It is reported to be as effective as vitamin C in regulating collagen biosynthesis, and as an anti-oxidant. | | Definition | ChEBI: Magnesium L-ascorbic acid-2-phosphate is an organic molecular entity. |
| | Magnesium ascorbyl phosphate Preparation Products And Raw materials |
|