|  | |  |  | 2-Bromo-9,9-dimethylfluorene Basic information | 
 | Product Name: | 2-Bromo-9,9-dimethylfluorene |  | Synonyms: | 2-broMo-9,9-diMethyl-9H-fluorene
(2BDMF);2--9,9-two MethylbroMidefluorene;9H-Fluorene,2-broMo-9,9-diMethyl-;9,9-Dimethyl-2-bromofluorenone;2-bromo-9,9-dimethyl-fluororene;2-Bromo-9,9-dimethylfluorene;2-Bromo-9,9-dimethylfluuoren;2-BROMO-9,9-DIMETHYLFLUOROENE |  | CAS: | 28320-31-2 |  | MF: | C15H13Br |  | MW: | 273.17 |  | EINECS: | 694-710-3 |  | Product Categories: | OLED;OLED materials,pharm chemical,electronic;Fluorene Derivatives;Electronic Chemicals;Fluorene Series;organic chemicals and derivatives/others;28320-31-2 |  | Mol File: | 28320-31-2.mol |  |  | 
|  |  | 2-Bromo-9,9-dimethylfluorene Chemical Properties | 
 | Melting point | 68°C |  | Boiling point | 190°C/2mmHg(lit.) |  | density | 1.346±0.06 g/cm3(Predicted) |  | storage temp. | Sealed in dry,Room Temperature |  | form | powder to crystal |  | color | White to Almost white |  | Water Solubility | Slightly soluble in water. |  | InChI | InChI=1S/C15H13Br/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15/h3-9H,1-2H3 |  | InChIKey | MBHPOBSZPYEADG-UHFFFAOYSA-N |  | SMILES | C1(C)(C)C2=C(C=CC=C2)C2=C1C=C(Br)C=C2 |  | CAS DataBase Reference | 28320-31-2(CAS DataBase Reference) | 
| Hazard Codes | N |  | Risk Statements | 51/53 |  | Safety Statements | 61 |  | RIDADR | UN 3077 9 / PGIII |  | WGK Germany | 3 |  | HS Code | 29049090 | 
|  |  | 2-Bromo-9,9-dimethylfluorene Usage And Synthesis | 
 | Chemical Properties | White power |  | Uses | 2-Bromo-9,9-dimethylfluorene can be used as a conducting polymer in the fabrication of a variety of devices which include photoelectronic devices, organic light emitting diodes (OLEDs) and organic solar cells (OSCs). |  | General Description | 2-Bromo-9,9-dimethylfluorene is a fluorene derivative which shows π-electron conjugation. It has a high fluorescent and high electron delocalization. It can be used as a non-linear optical (NLO) material. It can be synthesized by using 2-bromofluorene and iodomethane as the major reactants. It can be majorly used in organic electronic based applications. | 
|  |  | 2-Bromo-9,9-dimethylfluorene Preparation Products And Raw materials | 
 |