|
| | 2-Chloro-5-chloromethylpyridine Chemical Properties |
| Melting point | 37-42 °C(lit.) | | Boiling point | 267.08°C (rough estimate) | | density | 1.4411 (rough estimate) | | refractive index | 1.6000 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Moist Crystals | | pka | -0.75±0.10(Predicted) | | color | Beige | | Water Solubility | Insoluble in water. | | BRN | 1635690 | | InChI | InChI=1S/C6H5Cl2N/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3H2 | | InChIKey | SKCNYHLTRZIINA-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(CCl)C=C1 | | CAS DataBase Reference | 70258-18-3(CAS DataBase Reference) |
| Hazard Codes | C,Xi,F | | Risk Statements | 22-34-36-10 | | Safety Statements | 26-36/37/39-45-25-36-16 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Harmful | | HazardClass | LACHRYMATOR, CORROSIVE | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29333999 |
| | 2-Chloro-5-chloromethylpyridine Usage And Synthesis |
| Description | 2-Chloro-5-chloromethylpyridine is used for the synthesis of various pharmaceutical compounds. It can also be used for the synthesis of new neonicotinoid compounds1, having insecticidal activity. It is the raw material of pesticide products such as imidacloprid, acetamiprid as well as bactericide and herbicide2,3.
| | Sources |
- https://www.alfa.com/en/catalog/L19284/
- https://www.trc-canada.com/product-detail/?C364715
- www.szqhbio.com/wap_news_detailen/id/1.htm
| | Chemical Properties | beige moist crystals | | Uses | 2-Chloro-5-(chloromethyl)pyridine is used for the synthesis of various pharmaceutical compounds. It can also be used for the synthesis of new neonicotinoid compounds. |
| | 2-Chloro-5-chloromethylpyridine Preparation Products And Raw materials |
|