|  | |  |  | 1-Methylindazole-3-carboxylic acid Basic information | 
|  |  | 1-Methylindazole-3-carboxylic acid Chemical Properties | 
 | Melting point | 213 °C |  | Boiling point | 383.7±15.0 °C(Predicted) |  | density | 1.35±0.1 g/cm3(Predicted) |  | storage temp. | Keep in dark place,Sealed in dry,Room Temperature |  | solubility | DMSO (Slightly), Methanol (Slightly) |  | pka | 3.14±0.10(Predicted) |  | form | Solid |  | color | White to Off White |  | Water Solubility | Insoluble in water. Soluble in DMSO and Methanol. |  | InChI | InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(10-11)9(12)13/h2-5H,1H3,(H,12,13) |  | InChIKey | OVVDFORZEGKEJM-UHFFFAOYSA-N |  | SMILES | N1(C)C2=C(C=CC=C2)C(C(O)=O)=N1 |  | CAS DataBase Reference | 50890-83-0(CAS DataBase Reference) | 
|  |  | 1-Methylindazole-3-carboxylic acid Usage And Synthesis | 
 | Chemical Properties | Off White Solid |  | Uses | Granisetron Impurity D. |  | Uses | 1-Methylindazole-3-carboxylic acid is used as important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. It is also used as a pharmaceutical adjuvant, Granisetron Impurity D. |  | Synthesis Reference(s) | The Journal of Organic Chemistry, 63, p. 8448, 1998 DOI: 10.1021/jo981557o | 
|  |  | 1-Methylindazole-3-carboxylic acid Preparation Products And Raw materials | 
 |