|  | |  |  | 1-Bromo-2,5-difluorobenzene Basic information | 
|  |  | 1-Bromo-2,5-difluorobenzene Chemical Properties | 
 | Melting point | −31 °C(lit.) |  | Boiling point | 58-59 °C20 mm Hg(lit.) |  | density | 1.708 g/mL at 25 °C(lit.) |  | refractive index | n20/D 1.508(lit.) |  | Fp | 149 °F |  | storage temp. | Sealed in dry,Room Temperature |  | form | clear liquid |  | color | Colorless to Light yellow to Light orange |  | Specific Gravity | 1.708 |  | Water Solubility | Insoluble |  | BRN | 1680893 |  | InChI | InChI=1S/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H |  | InChIKey | XCRCSPKQEDMVBO-UHFFFAOYSA-N |  | SMILES | C1(F)=CC=C(F)C=C1Br |  | CAS DataBase Reference | 399-94-0(CAS DataBase Reference) |  | NIST Chemistry Reference | Benzene, 2-bromo-1,4-difluoro-(399-94-0) | 
|  |  | 1-Bromo-2,5-difluorobenzene Usage And Synthesis | 
 | Chemical Properties | CLEAR COLOURLESS LIQUID |  | Uses | 2-Bromo-1,4-difluorobenzene has been used in the preparation of 1,4-difluoroanthraquinone, a precursor to ametantrone. |  | General Description | Lithiation of 2-bromo-1,4-difluorobenzene in the presence of lithium diisopropylamide (LDA) in THF-hexane, butyllithium in diethyl ether-hexane and butyllithium in THF-hexane has been reported. | 
|  |  | 1-Bromo-2,5-difluorobenzene Preparation Products And Raw materials | 
 |