|
| | Cytidine 5’-monophosphate Basic information |
| | Cytidine 5’-monophosphate Chemical Properties |
| Melting point | ~222 °C (dec.) | | Boiling point | 678.1±65.0 °C(Predicted) | | density | 2.15±0.1 g/cm3(Predicted) | | refractive index | 9.8 ° (C=1, 0.5mol/L Na2HPO4) | | storage temp. | 2-8°C | | solubility | Water (Slightly, Heated) | | pka | pK2:4.39(0);pK3:6.62(+1) (25°C) | | form | crystalline | | color | White | | Water Solubility | soluble | | BRN | 46982 | | InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 | | InChIKey | IERHLVCPSMICTF-JDNPWWSISA-N | | SMILES | P(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](O)[C@@H]1O)(O)(O)=O | | CAS DataBase Reference | 63-37-6(CAS DataBase Reference) | | EPA Substance Registry System | 5'-Cytidylic acid (63-37-6) |
| | Cytidine 5’-monophosphate Usage And Synthesis |
| Description | Cytidine 5'-monophosphate, also known as 5'-CMP, is a nucleotide that is used as a monomer in RNA. 5'-CMP is a key intermediate in the preparation of several nucleotide derivatives and is widely used in food and pharmaceutical industries. | | Chemical Properties | white crystalline powder | | Uses | A constituent of nucleic acids. It was isolated from yeast nucleic acid. | | Uses | Cytidine 5′-monophosphate has been used in Raman spectroscopy studies. | | Definition | ChEBI: A pyrimidine ribonucleoside 5'-monophosphate having cytosine as the nucleobase. | | Biochem/physiol Actions | Cytidine 5′-monophosphate (CMP) is used as a substrate of uridine monophosphate (UMP)/cytidine monophosphate (CMP) kinase (EC 2.7.4.4) to form CDP which upon phosphorylation to CTP supports DNA and RNA biosynthesis. |
| | Cytidine 5’-monophosphate Preparation Products And Raw materials |
|