|
| | 3-Tolylboronic acid Basic information |
| | 3-Tolylboronic acid Chemical Properties |
| Melting point | 160-162 °C(lit.) | | Boiling point | 290.4±33.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Slightly soluble in water | | pka | 8.63±0.10(Predicted) | | form | Powder and Chunks | | color | Beige | | BRN | 2935968 | | InChI | InChI=1S/C7H9BO2/c1-6-3-2-4-7(5-6)8(9)10/h2-5,9-10H,1H3 | | InChIKey | BJQCPCFFYBKRLM-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(C)=C1)(O)O | | CAS DataBase Reference | 17933-03-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | ED7788888 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29163990 |
| | 3-Tolylboronic acid Usage And Synthesis |
| Chemical Properties | Off-white Cryst | | Uses | 3-methylphenylboronic acid can be used in Suzuki coupling reactions and is studied in the field of chemical engineering. | | Application | 3-Tolylboronic acid is an impurity of Eltrombopag, Eltrombopag is used to treat low blood platelet counts in adults with chronic immune (idiopathic) thrombocytopenia (ITP), when certain other medicines, or surgery to remove the spleen, have not worked well enough. |
| | 3-Tolylboronic acid Preparation Products And Raw materials |
|