|
| | potassium(R) 3-hydroxybutyrate Basic information |
| Product Name: | potassium(R) 3-hydroxybutyrate | | Synonyms: | potassium(R) 3-hydroxybutyrate;(R)-3-Hydroxybutanoic Acid Potassium Salt;(R)-3-Hlylrwxybutyris Acid,Potnssium;D-3-Hydroxybuturic acid;R-3-Hyrdoxybutyric acid, Potassium salt;R-3-Hyrdoxybutyric acid, Sodium salt;R-3-Hyrdoxybutyric acid, Calcium salt;(R)-3-Hydroxybutyric Acid, Potassium | | CAS: | 110972-51-5 | | MF: | C4H7KO3 | | MW: | 142.19488 | | EINECS: | | | Product Categories: | | | Mol File: | 110972-51-5.mol |  |
| | potassium(R) 3-hydroxybutyrate Chemical Properties |
| InChI | InChI=1/C4H8O3.K/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/s3 | | InChIKey | CINYGFCEISABSR-OQFXAWDINA-M | | SMILES | [K+].C([O-])(=O)C[C@H](O)C |&1:5,r| |
| | potassium(R) 3-hydroxybutyrate Usage And Synthesis |
| Uses | (R)-3-Hydroxybutyrate, potassium salt is used as a food supplement in ketogenic diet. | | General Description | Poly-(R)-3-hydroxybutyrates (PHB) are linear polymers of (R)-3-hydroxybutyrate. They are components of all biological cells[1]. | | References | [1] Physiological importance of poly-(R)-3-hydroxybutyrates. DOI: 10.1002/cbdv.201200278. |
| | potassium(R) 3-hydroxybutyrate Preparation Products And Raw materials |
|