|
| | QUINOLINE-4-CARBOXYLIC ACID Basic information |
| | QUINOLINE-4-CARBOXYLIC ACID Chemical Properties |
| Melting point | 254-255 °C (lit.) | | Boiling point | 348.7±15.0 °C(Predicted) | | density | 1.339±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | powder to crystal | | pka | 1.03±0.10(Predicted) | | color | White to Light yellow | | BRN | 5224 | | InChI | InChI=1S/C10H7NO2/c12-10(13)8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H,12,13) | | InChIKey | VQMSRUREDGBWKT-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(C(O)=O)=CC=1 | | CAS DataBase Reference | 486-74-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | GD3850000 | | HazardClass | IRRITANT | | HS Code | 29334900 |
| | QUINOLINE-4-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | Quinoline-4-carboxylic Acid for small therapeutic agent compounds. | | Definition | ChEBI: Quinoline-4-carboxylic acid is a quinolinemonocarboxylic acid. It is a conjugate acid of a quinoline-4-carboxylate. | | Biochem/physiol Actions | 4-Quinolinecarboxylic acid showed anti-tumor activity against L1210 leukemia and B16 melanoma. | | Metabolic pathway | The bacterium which is isolated from soil enrichment
culture degrades quinoline-4-carboxylic acid to give
the two identified metabolites 2-oxo-1,2-
dihydroquinoline-4-carboxylic acid and 8-hydroxy-2-
oxo-2H-benzopyran-4-carboxylic acid. |
| | QUINOLINE-4-CARBOXYLIC ACID Preparation Products And Raw materials |
|